C8H9NNa2O6S3 — CID 155663630
disodium;2-(5-ethenyl-4-methyl-1,3-thiazol-2-yl)ethane-1,1-disulfonate (PubChem CID 155663630) has the molecular formula C8H9NNa2O6S3 and a molecular weight of 357.34 g/mol. Its IUPAC name is disodium;2-(5-ethenyl-4-methyl-1,3-thiazol-2-yl)ethane-1,1-disulfonate.
| Compound Name | disodium;2-(5-ethenyl-4-methyl-1,3-thiazol-2-yl)ethane-1,1-disulfonate |
|---|---|
| PubChem CID | 155663630 |
| Molecular Formula | C8H9NNa2O6S3 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | disodium;2-(5-ethenyl-4-methyl-1,3-thiazol-2-yl)ethane-1,1-disulfonate |
| SMILES | C=Cc1sc(CC(S(=O)(=O)[O-])S(=O)(=O)[O-])nc1C.[Na+].[Na+] |
| InChI | InChI=1S/C8H11NO6S3.2Na/c1-3-6-5(2)9-7(16-6)4-8(17(10,11)12)18(13,14)15;;/h3,8H,1,4H2,2H3,(H,10,11,12)(H,13,14,15);;/q;2*+1/p-2 |
| InChIKey | GFKXXZZCGJPHOA-UHFFFAOYSA-L |
| XLogP | -5.94 |
| TPSA | 127.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | -5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|