C10H17NO2S — CID 103454583
1-(4,5-dimethyl-1,3-thiazol-2-yl)pentane-2,3-diol (PubChem CID 103454583) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)pentane-2,3-diol.
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)pentane-2,3-diol |
|---|---|
| PubChem CID | 103454583 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)pentane-2,3-diol |
| SMILES | CCC(O)C(O)Cc1nc(C)c(C)s1 |
| InChI | InChI=1S/C10H17NO2S/c1-4-8(12)9(13)5-10-11-6(2)7(3)14-10/h8-9,12-13H,4-5H2,1-3H3 |
| InChIKey | SHTVUELDUSNEOB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |