C7H14N2S — CID 69061774
azane;2-ethyl-4,5-dimethyl-1,3-thiazole (PubChem CID 69061774) has the molecular formula C7H14N2S and a molecular weight of 158.27 g/mol. Its IUPAC name is azane;2-ethyl-4,5-dimethyl-1,3-thiazole.
| Compound Name | azane;2-ethyl-4,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 69061774 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | azane;2-ethyl-4,5-dimethyl-1,3-thiazole |
| SMILES | CCc1nc(C)c(C)s1.N |
| InChI | InChI=1S/C7H11NS.H3N/c1-4-7-8-5(2)6(3)9-7;/h4H2,1-3H3;1H3 |
| InChIKey | WEEBBSCCTUZKNA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |