C9H13NOS — CID 65168475
1-(4,5-dimethyl-1,3-thiazol-2-yl)butan-2-one (PubChem CID 65168475) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is 1-(4,5-dimethyl-1,3-thiazol-2-yl)butan-2-one.
| Compound Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)butan-2-one |
|---|---|
| PubChem CID | 65168475 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 1-(4,5-dimethyl-1,3-thiazol-2-yl)butan-2-one |
| SMILES | CCC(=O)Cc1nc(C)c(C)s1 |
| InChI | InChI=1S/C9H13NOS/c1-4-8(11)5-9-10-6(2)7(3)12-9/h4-5H2,1-3H3 |
| InChIKey | VPNIAYXZVRZEMQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |