C11H17NOS — CID 178049225
ethane;5-ethenyl-4-(1-methoxyethenyl)-2-methyl-1,3-thiazole (PubChem CID 178049225) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is ethane;5-ethenyl-4-(1-methoxyethenyl)-2-methyl-1,3-thiazole.
| Compound Name | ethane;5-ethenyl-4-(1-methoxyethenyl)-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 178049225 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | ethane;5-ethenyl-4-(1-methoxyethenyl)-2-methyl-1,3-thiazole |
| SMILES | C=Cc1sc(C)nc1C(=C)OC.CC |
| InChI | InChI=1S/C9H11NOS.C2H6/c1-5-8-9(6(2)11-4)10-7(3)12-8;1-2/h5H,1-2H2,3-4H3;1-2H3 |
| InChIKey | MEKCVDRILKLEFV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|