C11H16N2O3S — CID 110465551
methyl 4-[(2,5-dimethyl-1,3-thiazole-4-carbonyl)amino]butanoate (PubChem CID 110465551) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is methyl 4-[(2,5-dimethyl-1,3-thiazole-4-carbonyl)amino]butanoate.
| Compound Name | methyl 4-[(2,5-dimethyl-1,3-thiazole-4-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 110465551 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | methyl 4-[(2,5-dimethyl-1,3-thiazole-4-carbonyl)amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1nc(C)sc1C |
| InChI | InChI=1S/C11H16N2O3S/c1-7-10(13-8(2)17-7)11(15)12-6-4-5-9(14)16-3/h4-6H2,1-3H3,(H,12,15) |
| InChIKey | YMJFLPQZZJOIJC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|