C11H13ClN2O3 — CID 62233867
methyl 4-[(6-chloropyridine-2-carbonyl)amino]butanoate (PubChem CID 62233867) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is methyl 4-[(6-chloropyridine-2-carbonyl)amino]butanoate.
| Compound Name | methyl 4-[(6-chloropyridine-2-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 62233867 |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | methyl 4-[(6-chloropyridine-2-carbonyl)amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)c1cccc(Cl)n1 |
| InChI | InChI=1S/C11H13ClN2O3/c1-17-10(15)6-3-7-13-11(16)8-4-2-5-9(12)14-8/h2,4-5H,3,6-7H2,1H3,(H,13,16) |
| InChIKey | MKBONKLTYLGEIC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|