C9H11NOS — CID 123538949
4-ethenyl-5-(1-methoxyethenyl)-2-methyl-1,3-thiazole (PubChem CID 123538949) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 4-ethenyl-5-(1-methoxyethenyl)-2-methyl-1,3-thiazole.
| Compound Name | 4-ethenyl-5-(1-methoxyethenyl)-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 123538949 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 4-ethenyl-5-(1-methoxyethenyl)-2-methyl-1,3-thiazole |
| SMILES | C=Cc1nc(C)sc1C(=C)OC |
| InChI | InChI=1S/C9H11NOS/c1-5-8-9(6(2)11-4)12-7(3)10-8/h5H,1-2H2,3-4H3 |
| InChIKey | VCPWEBLNTJTJCR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|