C7H9N3O2S — CID 130610590
N-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]formamide (PubChem CID 130610590) has the molecular formula C7H9N3O2S and a molecular weight of 199.23 g/mol. Its IUPAC name is N-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]formamide.
| Compound Name | N-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]formamide |
|---|---|
| PubChem CID | 130610590 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | N-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]formamide |
| SMILES | Cc1nc(C)c(C(=O)NNC=O)s1 |
| InChI | InChI=1S/C7H9N3O2S/c1-4-6(13-5(2)9-4)7(12)10-8-3-11/h3H,1-2H3,(H,8,11)(H,10,12) |
| InChIKey | WATJPOQAWLBWFR-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|