C13H12ClN3O2S — CID 2744486
N'-(4-chlorobenzoyl)-2,4-dimethyl-1,3-thiazole-5-carbohydrazide (PubChem CID 2744486) has the molecular formula C13H12ClN3O2S and a molecular weight of 309.78 g/mol. Its IUPAC name is N'-(4-chlorobenzoyl)-2,4-dimethyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-(4-chlorobenzoyl)-2,4-dimethyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 2744486 |
| Molecular Formula | C13H12ClN3O2S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | N'-(4-chlorobenzoyl)-2,4-dimethyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(C)c(C(=O)NNC(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C13H12ClN3O2S/c1-7-11(20-8(2)15-7)13(19)17-16-12(18)9-3-5-10(14)6-4-9/h3-6H,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | HAHLUYADNBAPIR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|