C13H12ClN3OS — CID 168887163
N-[(Z)-[(4-chlorophenyl)-(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]amino]formamide (PubChem CID 168887163) has the molecular formula C13H12ClN3OS and a molecular weight of 293.78 g/mol. Its IUPAC name is N-[(Z)-[(4-chlorophenyl)-(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]amino]formamide.
| Compound Name | N-[(Z)-[(4-chlorophenyl)-(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]amino]formamide |
|---|---|
| PubChem CID | 168887163 |
| Molecular Formula | C13H12ClN3OS |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | N-[(Z)-[(4-chlorophenyl)-(2,4-dimethyl-1,3-thiazol-5-yl)methylidene]amino]formamide |
| SMILES | Cc1nc(C)c(/C(=N\NC=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C13H12ClN3OS/c1-8-13(19-9(2)16-8)12(17-15-7-18)10-3-5-11(14)6-4-10/h3-7H,1-2H3,(H,15,18)/b17-12- |
| InChIKey | MOWMIYRUURXAIH-ATVHPVEESA-N |
| XLogP | 2.91 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|