C12H10ClIN2OS — CID 103766762
N-(4-chloro-2-iodophenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 103766762) has the molecular formula C12H10ClIN2OS and a molecular weight of 392.65 g/mol. Its IUPAC name is N-(4-chloro-2-iodophenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-chloro-2-iodophenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 103766762 |
| Molecular Formula | C12H10ClIN2OS |
| Molecular Weight | 392.65 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | N-(4-chloro-2-iodophenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(Cl)cc2I)s1 |
| InChI | InChI=1S/C12H10ClIN2OS/c1-6-11(18-7(2)15-6)12(17)16-10-4-3-8(13)5-9(10)14/h3-5H,1-2H3,(H,16,17) |
| InChIKey | ICAVDHZZPZRTPO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|