C12H11IN2OS — CID 17399100
N-(3-iodophenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide (PubChem CID 17399100) has the molecular formula C12H11IN2OS and a molecular weight of 358.20 g/mol. Its IUPAC name is N-(3-iodophenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(3-iodophenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 17399100 |
| Molecular Formula | C12H11IN2OS |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | N-(3-iodophenyl)-2,4-dimethyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2cccc(I)c2)s1 |
| InChI | InChI=1S/C12H11IN2OS/c1-7-11(17-8(2)14-7)12(16)15-10-5-3-4-9(13)6-10/h3-6H,1-2H3,(H,15,16) |
| InChIKey | QIYIJWQORAWWKE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|