C13H11IN2O3S — CID 45345743
2-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]-5-iodobenzoic acid (PubChem CID 45345743) has the molecular formula C13H11IN2O3S and a molecular weight of 402.21 g/mol. Its IUPAC name is 2-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]-5-iodobenzoic acid.
| Compound Name | 2-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]-5-iodobenzoic acid |
|---|---|
| PubChem CID | 45345743 |
| Molecular Formula | C13H11IN2O3S |
| Molecular Weight | 402.21 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | 2-[(2,4-dimethyl-1,3-thiazole-5-carbonyl)amino]-5-iodobenzoic acid |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(I)cc2C(=O)O)s1 |
| InChI | InChI=1S/C13H11IN2O3S/c1-6-11(20-7(2)15-6)12(17)16-10-4-3-8(14)5-9(10)13(18)19/h3-5H,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | XYGFDEFIJSCTIP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|