About 2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride
2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride (PubChem CID 69278427) has the molecular formula C6H9ClN2OS
and a molecular weight of 192.67 g/mol. Its IUPAC name is 2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride.
Analyze 2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride?
The IUPAC name of 2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride (CID 69278427) is 2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride.
What is the SMILES notation for 2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride?
The canonical SMILES for 2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride is Cc1nc(C)c(C(N)=O)s1.Cl.
What is the InChIKey of 2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride?
The InChIKey is OYQZVTKGTGEMJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS.ClH/c1-3-5(6(7)9)10-4(2)8-3;/h1-2H3,(H2,7,9);1H.
What are the key properties of 2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride?
2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride has a molecular weight of 192.67 g/mol, XLogP of 1.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1,3-thiazole-5-carboxamide;hydrochloride is sourced from PubChem (CID 69278427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).