About (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone
(2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone (PubChem CID 130979221) has the molecular formula C8H9N5OS
and a molecular weight of 223.26 g/mol. Its IUPAC name is (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone.
Molecular Properties
| Compound Name | (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone |
| PubChem CID | 130979221 |
| Molecular Formula | C8H9N5OS |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone |
| SMILES | Cc1nc(C)c(C(=O)c2nnn(C)n2)s1 |
| InChI | InChI=1S/C8H9N5OS/c1-4-7(15-5(2)9-4)6(14)8-10-12-13(3)11-8/h1-3H3 |
| InChIKey | VAIBKNODHMPMAO-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 73.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone?
The IUPAC name of (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone (CID 130979221) is (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone.
What is the SMILES notation for (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone?
The canonical SMILES for (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone is Cc1nc(C)c(C(=O)c2nnn(C)n2)s1.
What is the InChIKey of (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone?
The InChIKey is VAIBKNODHMPMAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5OS/c1-4-7(15-5(2)9-4)6(14)8-10-12-13(3)11-8/h1-3H3.
What are the key properties of (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone?
(2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone has a molecular weight of 223.26 g/mol, XLogP of 0.51, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethyl-1,3-thiazol-5-yl)-(2-methyltetrazol-5-yl)methanone is sourced from PubChem (CID 130979221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).