C9H12N2 — CID 145409646
4-ethenyl-2,5,6-trimethylpyrimidine (PubChem CID 145409646) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 4-ethenyl-2,5,6-trimethylpyrimidine.
| Compound Name | 4-ethenyl-2,5,6-trimethylpyrimidine |
|---|---|
| PubChem CID | 145409646 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 4-ethenyl-2,5,6-trimethylpyrimidine |
| SMILES | C=Cc1nc(C)nc(C)c1C |
| InChI | InChI=1S/C9H12N2/c1-5-9-6(2)7(3)10-8(4)11-9/h5H,1H2,2-4H3 |
| InChIKey | GBILGSUSHNAQSG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |