C10H14N2 — CID 174547893
4,5,6-trimethyl-2-prop-2-enylpyrimidine (PubChem CID 174547893) has the molecular formula C10H14N2 and a molecular weight of 162.24 g/mol. Its IUPAC name is 4,5,6-trimethyl-2-prop-2-enylpyrimidine.
| Compound Name | 4,5,6-trimethyl-2-prop-2-enylpyrimidine |
|---|---|
| PubChem CID | 174547893 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 4,5,6-trimethyl-2-prop-2-enylpyrimidine |
| SMILES | C=CCc1nc(C)c(C)c(C)n1 |
| InChI | InChI=1S/C10H14N2/c1-5-6-10-11-8(3)7(2)9(4)12-10/h5H,1,6H2,2-4H3 |
| InChIKey | BNINWFMJYADJSM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|