C17H28N4 — CID 175096673
N-octyl-4,6-bis(prop-2-enyl)-1,3,5-triazin-2-amine (PubChem CID 175096673) has the molecular formula C17H28N4 and a molecular weight of 288.44 g/mol. Its IUPAC name is N-octyl-4,6-bis(prop-2-enyl)-1,3,5-triazin-2-amine.
| Compound Name | N-octyl-4,6-bis(prop-2-enyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 175096673 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | N-octyl-4,6-bis(prop-2-enyl)-1,3,5-triazin-2-amine |
| SMILES | C=CCc1nc(CC=C)nc(NCCCCCCCC)n1 |
| InChI | InChI=1S/C17H28N4/c1-4-7-8-9-10-11-14-18-17-20-15(12-5-2)19-16(21-17)13-6-3/h5-6H,2-4,7-14H2,1H3,(H,18,19,20,21) |
| InChIKey | HZTFEKBFPIBJBZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|