C9H12N2O — CID 70353542
5,6-dimethyl-3-prop-2-enyl-1H-pyrazin-2-one (PubChem CID 70353542) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 5,6-dimethyl-3-prop-2-enyl-1H-pyrazin-2-one.
| Compound Name | 5,6-dimethyl-3-prop-2-enyl-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 70353542 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 5,6-dimethyl-3-prop-2-enyl-1H-pyrazin-2-one |
| SMILES | C=CCc1nc(C)c(C)[nH]c1=O |
| InChI | InChI=1S/C9H12N2O/c1-4-5-8-9(12)11-7(3)6(2)10-8/h4H,1,5H2,2-3H3,(H,11,12) |
| InChIKey | FXEWOZIVNFJXHL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|