C12H16N2 — CID 23504290
2,4,5-tris(prop-2-enyl)-1H-imidazole (PubChem CID 23504290) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2,4,5-tris(prop-2-enyl)-1H-imidazole.
| Compound Name | 2,4,5-tris(prop-2-enyl)-1H-imidazole |
|---|---|
| PubChem CID | 23504290 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2,4,5-tris(prop-2-enyl)-1H-imidazole |
| SMILES | C=CCc1nc(CC=C)c(CC=C)[nH]1 |
| InChI | InChI=1S/C12H16N2/c1-4-7-10-11(8-5-2)14-12(13-10)9-6-3/h4-6H,1-3,7-9H2,(H,13,14) |
| InChIKey | MRJQYVQMEAZRDV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|