C9H6Br2N2OS — CID 70187836
5,7-dibromo-2-prop-2-enyl-4H-thieno[3,4-b]pyrazin-3-one (PubChem CID 70187836) has the molecular formula C9H6Br2N2OS and a molecular weight of 350.04 g/mol. Its IUPAC name is 5,7-dibromo-2-prop-2-enyl-4H-thieno[3,4-b]pyrazin-3-one.
| Compound Name | 5,7-dibromo-2-prop-2-enyl-4H-thieno[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 70187836 |
| Molecular Formula | C9H6Br2N2OS |
| Molecular Weight | 350.04 g/mol |
| Exact Mass | 347.86 |
| IUPAC Name | 5,7-dibromo-2-prop-2-enyl-4H-thieno[3,4-b]pyrazin-3-one |
| SMILES | C=CCc1nc2c(Br)sc(Br)c2[nH]c1=O |
| InChI | InChI=1S/C9H6Br2N2OS/c1-2-3-4-9(14)13-6-5(12-4)7(10)15-8(6)11/h2H,1,3H2,(H,13,14) |
| InChIKey | FKFXTWCEHLVBJE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.04 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|