C9H9F3N2 — CID 58549929
4-methyl-2-prop-2-enyl-6-(trifluoromethyl)pyrimidine (PubChem CID 58549929) has the molecular formula C9H9F3N2 and a molecular weight of 202.18 g/mol. Its IUPAC name is 4-methyl-2-prop-2-enyl-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-methyl-2-prop-2-enyl-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 58549929 |
| Molecular Formula | C9H9F3N2 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 4-methyl-2-prop-2-enyl-6-(trifluoromethyl)pyrimidine |
| SMILES | C=CCc1nc(C)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H9F3N2/c1-3-4-8-13-6(2)5-7(14-8)9(10,11)12/h3,5H,1,4H2,2H3 |
| InChIKey | PKBNGMKIVLCWHN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|