C8H10N2O — CID 87170202
2-(4,6-dimethylpyrimidin-2-yl)acetaldehyde (PubChem CID 87170202) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)acetaldehyde.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)acetaldehyde |
|---|---|
| PubChem CID | 87170202 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)acetaldehyde |
| SMILES | Cc1cc(C)nc(CC=O)n1 |
| InChI | InChI=1S/C8H10N2O/c1-6-5-7(2)10-8(9-6)3-4-11/h4-5H,3H2,1-2H3 |
| InChIKey | HHEGVWVBLHNWGT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|