C26H36N2 — CID 91135840
1,2,3,4,5,6,7,8-octamethylnaphthalene;2,4,5,6-tetramethylpyrimidine (PubChem CID 91135840) has the molecular formula C26H36N2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octamethylnaphthalene;2,4,5,6-tetramethylpyrimidine.
| Compound Name | 1,2,3,4,5,6,7,8-octamethylnaphthalene;2,4,5,6-tetramethylpyrimidine |
|---|---|
| PubChem CID | 91135840 |
| Molecular Formula | C26H36N2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octamethylnaphthalene;2,4,5,6-tetramethylpyrimidine |
| SMILES | Cc1c(C)c(C)c2c(C)c(C)c(C)c(C)c2c1C.Cc1nc(C)c(C)c(C)n1 |
| InChI | InChI=1S/C18H24.C8H12N2/c1-9-10(2)14(6)18-16(8)12(4)11(3)15(7)17(18)13(9)5;1-5-6(2)9-8(4)10-7(5)3/h1-8H3;1-4H3 |
| InChIKey | GWLYZTDIIZLIEW-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |