C10H13N — CID 91244758
6-ethenyl-2,3,4-trimethylpyridine (PubChem CID 91244758) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 6-ethenyl-2,3,4-trimethylpyridine.
| Compound Name | 6-ethenyl-2,3,4-trimethylpyridine |
|---|---|
| PubChem CID | 91244758 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 6-ethenyl-2,3,4-trimethylpyridine |
| SMILES | C=Cc1cc(C)c(C)c(C)n1 |
| InChI | InChI=1S/C10H13N/c1-5-10-6-7(2)8(3)9(4)11-10/h5-6H,1H2,2-4H3 |
| InChIKey | UFXZWANMWBUTJI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |