About 6-ethenyl-2,3,4-trimethylpyridine
6-ethenyl-2,3,4-trimethylpyridine (PubChem CID 91244758) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 6-ethenyl-2,3,4-trimethylpyridine.
Molecular Properties
| Compound Name | 6-ethenyl-2,3,4-trimethylpyridine |
| PubChem CID | 91244758 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 6-ethenyl-2,3,4-trimethylpyridine |
| SMILES | C=Cc1cc(C)c(C)c(C)n1 |
| InChI | InChI=1S/C10H13N/c1-5-10-6-7(2)8(3)9(4)11-10/h5-6H,1H2,2-4H3 |
| InChIKey | UFXZWANMWBUTJI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-ethenyl-2,3,4-trimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethenyl-2,3,4-trimethylpyridine?
The IUPAC name of 6-ethenyl-2,3,4-trimethylpyridine (CID 91244758) is 6-ethenyl-2,3,4-trimethylpyridine.
What is the SMILES notation for 6-ethenyl-2,3,4-trimethylpyridine?
The canonical SMILES for 6-ethenyl-2,3,4-trimethylpyridine is C=Cc1cc(C)c(C)c(C)n1.
What is the InChIKey of 6-ethenyl-2,3,4-trimethylpyridine?
The InChIKey is UFXZWANMWBUTJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-5-10-6-7(2)8(3)9(4)11-10/h5-6H,1H2,2-4H3.
What are the key properties of 6-ethenyl-2,3,4-trimethylpyridine?
6-ethenyl-2,3,4-trimethylpyridine has a molecular weight of 147.22 g/mol, XLogP of 2.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethenyl-2,3,4-trimethylpyridine is sourced from PubChem (CID 91244758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).