C9H16N2S — CID 82373516
2,5-di(propan-2-yl)-1,3-thiazol-4-amine (PubChem CID 82373516) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 2,5-di(propan-2-yl)-1,3-thiazol-4-amine.
| Compound Name | 2,5-di(propan-2-yl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 82373516 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2,5-di(propan-2-yl)-1,3-thiazol-4-amine |
| SMILES | CC(C)c1nc(N)c(C(C)C)s1 |
| InChI | InChI=1S/C9H16N2S/c1-5(2)7-8(10)11-9(12-7)6(3)4/h5-6H,10H2,1-4H3 |
| InChIKey | IHFVQUMQJIAQQC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |