C10H20N2S — CID 170954196
ethane;5-ethyl-2-propan-2-yl-1,3-thiazol-4-amine (PubChem CID 170954196) has the molecular formula C10H20N2S and a molecular weight of 200.35 g/mol. Its IUPAC name is ethane;5-ethyl-2-propan-2-yl-1,3-thiazol-4-amine.
| Compound Name | ethane;5-ethyl-2-propan-2-yl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 170954196 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | ethane;5-ethyl-2-propan-2-yl-1,3-thiazol-4-amine |
| SMILES | CC.CCc1sc(C(C)C)nc1N |
| InChI | InChI=1S/C8H14N2S.C2H6/c1-4-6-7(9)10-8(11-6)5(2)3;1-2/h5H,4,9H2,1-3H3;1-2H3 |
| InChIKey | NSIYFNDNKUGBQV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |