C13H24N2S — CID 63469688
4-heptyl-2-propan-2-yl-1,3-thiazol-5-amine (PubChem CID 63469688) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is 4-heptyl-2-propan-2-yl-1,3-thiazol-5-amine.
| Compound Name | 4-heptyl-2-propan-2-yl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 63469688 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 4-heptyl-2-propan-2-yl-1,3-thiazol-5-amine |
| SMILES | CCCCCCCc1nc(C(C)C)sc1N |
| InChI | InChI=1S/C13H24N2S/c1-4-5-6-7-8-9-11-12(14)16-13(15-11)10(2)3/h10H,4-9,14H2,1-3H3 |
| InChIKey | MDZGICSMWYKTQL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|