C11H18N2S — CID 62077188
2-cyclopropyl-4-pentyl-1,3-thiazol-5-amine (PubChem CID 62077188) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is 2-cyclopropyl-4-pentyl-1,3-thiazol-5-amine.
| Compound Name | 2-cyclopropyl-4-pentyl-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 62077188 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-cyclopropyl-4-pentyl-1,3-thiazol-5-amine |
| SMILES | CCCCCc1nc(C2CC2)sc1N |
| InChI | InChI=1S/C11H18N2S/c1-2-3-4-5-9-10(12)14-11(13-9)8-6-7-8/h8H,2-7,12H2,1H3 |
| InChIKey | XGDIWZHGLTTYMY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|