C10H16N2S2 — CID 116504998
2-cyclopropyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine (PubChem CID 116504998) has the molecular formula C10H16N2S2 and a molecular weight of 228.39 g/mol. Its IUPAC name is 2-cyclopropyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine.
| Compound Name | 2-cyclopropyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 116504998 |
| Molecular Formula | C10H16N2S2 |
| Molecular Weight | 228.39 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-cyclopropyl-4-(2-ethylsulfanylethyl)-1,3-thiazol-5-amine |
| SMILES | CCSCCc1nc(C2CC2)sc1N |
| InChI | InChI=1S/C10H16N2S2/c1-2-13-6-5-8-9(11)14-10(12-8)7-3-4-7/h7H,2-6,11H2,1H3 |
| InChIKey | QHLHIQSMEWDQRI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|