C16H29NS — CID 177141160
5-heptan-3-yl-2,4-di(propan-2-yl)-1,3-thiazole (PubChem CID 177141160) has the molecular formula C16H29NS and a molecular weight of 267.48 g/mol. Its IUPAC name is 5-heptan-3-yl-2,4-di(propan-2-yl)-1,3-thiazole.
| Compound Name | 5-heptan-3-yl-2,4-di(propan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 177141160 |
| Molecular Formula | C16H29NS |
| Molecular Weight | 267.48 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 5-heptan-3-yl-2,4-di(propan-2-yl)-1,3-thiazole |
| SMILES | CCCCC(CC)c1sc(C(C)C)nc1C(C)C |
| InChI | InChI=1S/C16H29NS/c1-7-9-10-13(8-2)15-14(11(3)4)17-16(18-15)12(5)6/h11-13H,7-10H2,1-6H3 |
| InChIKey | BAFLZWBARQMCCT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.48 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |