C13H24O2 — CID 170312233
4-heptan-3-yl-5-propan-2-yl-1,3-dioxole (PubChem CID 170312233) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 4-heptan-3-yl-5-propan-2-yl-1,3-dioxole.
| Compound Name | 4-heptan-3-yl-5-propan-2-yl-1,3-dioxole |
|---|---|
| PubChem CID | 170312233 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 4-heptan-3-yl-5-propan-2-yl-1,3-dioxole |
| SMILES | CCCCC(CC)C1=C(C(C)C)OCO1 |
| InChI | InChI=1S/C13H24O2/c1-5-7-8-11(6-2)13-12(10(3)4)14-9-15-13/h10-11H,5-9H2,1-4H3 |
| InChIKey | HWVUGHYTLAGHKJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |