C16H30O — CID 143716422
6-decan-3-yl-5-methyl-3,4-dihydro-2H-pyran (PubChem CID 143716422) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is 6-decan-3-yl-5-methyl-3,4-dihydro-2H-pyran.
| Compound Name | 6-decan-3-yl-5-methyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 143716422 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | 6-decan-3-yl-5-methyl-3,4-dihydro-2H-pyran |
| SMILES | CCCCCCCC(CC)C1=C(C)CCCO1 |
| InChI | InChI=1S/C16H30O/c1-4-6-7-8-9-12-15(5-2)16-14(3)11-10-13-17-16/h15H,4-13H2,1-3H3 |
| InChIKey | BSDQKQQXLFAPIP-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|