About ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran
ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran (PubChem CID 143716551) has the molecular formula C16H32S
and a molecular weight of 256.50 g/mol. Its IUPAC name is ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran.
Molecular Properties
| Compound Name | ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran |
| PubChem CID | 143716551 |
| Molecular Formula | C16H32S |
| Molecular Weight | 256.50 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran |
| SMILES | CC.CCCCCCC(C)C1=C(C)CCCS1 |
| InChI | InChI=1S/C14H26S.C2H6/c1-4-5-6-7-9-12(2)14-13(3)10-8-11-15-14;1-2/h12H,4-11H2,1-3H3;1-2H3 |
| InChIKey | UKRRUCWDSGCGOP-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 256.50 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran?
The IUPAC name of ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran (CID 143716551) is ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran.
What is the SMILES notation for ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran?
The canonical SMILES for ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran is CC.CCCCCCC(C)C1=C(C)CCCS1.
What is the InChIKey of ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran?
The InChIKey is UKRRUCWDSGCGOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26S.C2H6/c1-4-5-6-7-9-12(2)14-13(3)10-8-11-15-14;1-2/h12H,4-11H2,1-3H3;1-2H3.
What are the key properties of ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran?
ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran has a molecular weight of 256.50 g/mol, XLogP of 6.42, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methyl-6-octan-2-yl-3,4-dihydro-2H-thiopyran is sourced from PubChem (CID 143716551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).