About 2-[(2S)-2-methyloctyl]-1,3-dithiane
2-[(2S)-2-methyloctyl]-1,3-dithiane (PubChem CID 11447987) has the molecular formula C13H26S2
and a molecular weight of 246.48 g/mol. Its IUPAC name is 2-[(2S)-2-methyloctyl]-1,3-dithiane.
Molecular Properties
| Compound Name | 2-[(2S)-2-methyloctyl]-1,3-dithiane |
| PubChem CID | 11447987 |
| Molecular Formula | C13H26S2 |
| Molecular Weight | 246.48 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 2-[(2S)-2-methyloctyl]-1,3-dithiane |
| SMILES | CCCCCC[C@H](C)CC1SCCCS1 |
| InChI | InChI=1S/C13H26S2/c1-3-4-5-6-8-12(2)11-13-14-9-7-10-15-13/h12-13H,3-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | IGRYPMXLIIYWFX-LBPRGKRZSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.48 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S)-2-methyloctyl]-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-2-methyloctyl]-1,3-dithiane?
The IUPAC name of 2-[(2S)-2-methyloctyl]-1,3-dithiane (CID 11447987) is 2-[(2S)-2-methyloctyl]-1,3-dithiane.
What is the SMILES notation for 2-[(2S)-2-methyloctyl]-1,3-dithiane?
The canonical SMILES for 2-[(2S)-2-methyloctyl]-1,3-dithiane is CCCCCC[C@H](C)CC1SCCCS1.
What is the InChIKey of 2-[(2S)-2-methyloctyl]-1,3-dithiane?
The InChIKey is IGRYPMXLIIYWFX-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H26S2/c1-3-4-5-6-8-12(2)11-13-14-9-7-10-15-13/h12-13H,3-11H2,1-2H3/t12-/m0/s1.
What are the key properties of 2-[(2S)-2-methyloctyl]-1,3-dithiane?
2-[(2S)-2-methyloctyl]-1,3-dithiane has a molecular weight of 246.48 g/mol, XLogP of 5.18, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-2-methyloctyl]-1,3-dithiane is sourced from PubChem (CID 11447987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).