C9H18S2 — CID 19349487
2-(2-methylbutyl)-1,3-dithiane (PubChem CID 19349487) has the molecular formula C9H18S2 and a molecular weight of 190.38 g/mol. Its IUPAC name is 2-(2-methylbutyl)-1,3-dithiane.
| Compound Name | 2-(2-methylbutyl)-1,3-dithiane |
|---|---|
| PubChem CID | 19349487 |
| Molecular Formula | C9H18S2 |
| Molecular Weight | 190.38 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 2-(2-methylbutyl)-1,3-dithiane |
| SMILES | CCC(C)CC1SCCCS1 |
| InChI | InChI=1S/C9H18S2/c1-3-8(2)7-9-10-5-4-6-11-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | TUHAOOQWRIOZMG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |