About azane;2-methylbutylcyclohexane
azane;2-methylbutylcyclohexane (PubChem CID 143986613) has the molecular formula C11H25N
and a molecular weight of 171.33 g/mol. Its IUPAC name is azane;2-methylbutylcyclohexane.
Molecular Properties
| Compound Name | azane;2-methylbutylcyclohexane |
| PubChem CID | 143986613 |
| Molecular Formula | C11H25N |
| Molecular Weight | 171.33 g/mol |
| Exact Mass | 171.20 |
| IUPAC Name | azane;2-methylbutylcyclohexane |
| SMILES | CCC(C)CC1CCCCC1.N |
| InChI | InChI=1S/C11H22.H3N/c1-3-10(2)9-11-7-5-4-6-8-11;/h10-11H,3-9H2,1-2H3;1H3 |
| InChIKey | ZVRDAKWQFPQKMZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;2-methylbutylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methylbutylcyclohexane?
The IUPAC name of azane;2-methylbutylcyclohexane (CID 143986613) is azane;2-methylbutylcyclohexane.
What is the SMILES notation for azane;2-methylbutylcyclohexane?
The canonical SMILES for azane;2-methylbutylcyclohexane is CCC(C)CC1CCCCC1.N.
What is the InChIKey of azane;2-methylbutylcyclohexane?
The InChIKey is ZVRDAKWQFPQKMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22.H3N/c1-3-10(2)9-11-7-5-4-6-8-11;/h10-11H,3-9H2,1-2H3;1H3.
What are the key properties of azane;2-methylbutylcyclohexane?
azane;2-methylbutylcyclohexane has a molecular weight of 171.33 g/mol, XLogP of 4.16, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methylbutylcyclohexane is sourced from PubChem (CID 143986613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).