ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen

C10H24 — CID 145112018

IUPACethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen
SMILESCC.CC[C@H](C)CC1CC1.[H][H]
InChIInChI=1S/C8H16.C2H6.H2/c1-3-7(2)6-8-4-5-8;1-2;/h7-8H,3-6H2,1-2H3;1-2H3;1H/t7-;;/m0../s1
InChIKeyHSGMCSIVIXIMML-KLXURFKVSA-N
MW144.30 g/mol
LogP4.10
Rot. Bonds3

About ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen

ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen (PubChem CID 145112018) has the molecular formula C10H24 and a molecular weight of 144.30 g/mol. Its IUPAC name is ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen.

Molecular Properties

Compound Nameethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen
PubChem CID145112018
Molecular FormulaC10H24
Molecular Weight144.30 g/mol
Exact Mass144.19
IUPAC Nameethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen
SMILESCC.CC[C@H](C)CC1CC1.[H][H]
InChIInChI=1S/C8H16.C2H6.H2/c1-3-7(2)6-8-4-5-8;1-2;/h7-8H,3-6H2,1-2H3;1-2H3;1H/t7-;;/m0../s1
InChIKeyHSGMCSIVIXIMML-KLXURFKVSA-N
XLogP4.10
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.30
LogP ≤ 54.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen?
The IUPAC name of ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen (CID 145112018) is ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen.
What is the SMILES notation for ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen?
The canonical SMILES for ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen is CC.CC[C@H](C)CC1CC1.[H][H].
What is the InChIKey of ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen?
The InChIKey is HSGMCSIVIXIMML-KLXURFKVSA-N. The full InChI is InChI=1S/C8H16.C2H6.H2/c1-3-7(2)6-8-4-5-8;1-2;/h7-8H,3-6H2,1-2H3;1-2H3;1H/t7-;;/m0../s1.
What are the key properties of ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen?
ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen has a molecular weight of 144.30 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(2S)-2-methylbutyl]cyclopropane;molecular hydrogen is sourced from PubChem (CID 145112018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).