C16H34O2S2Si — CID 11002625
[2-(1,3-dithian-2-yl)-1-methoxyethoxy]-tri(propan-2-yl)silane (PubChem CID 11002625) has the molecular formula C16H34O2S2Si and a molecular weight of 350.67 g/mol. Its IUPAC name is [2-(1,3-dithian-2-yl)-1-methoxyethoxy]-tri(propan-2-yl)silane.
| Compound Name | [2-(1,3-dithian-2-yl)-1-methoxyethoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11002625 |
| Molecular Formula | C16H34O2S2Si |
| Molecular Weight | 350.67 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [2-(1,3-dithian-2-yl)-1-methoxyethoxy]-tri(propan-2-yl)silane |
| SMILES | COC(CC1SCCCS1)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H34O2S2Si/c1-12(2)21(13(3)4,14(5)6)18-15(17-7)11-16-19-9-8-10-20-16/h12-16H,8-11H2,1-7H3 |
| InChIKey | RAKUVALMRSLUKW-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.67 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|