C13H24O2S4 — CID 14197979
2-(2,2-dimethoxyethyl)-2-(1,3-dithian-2-ylmethyl)-1,3-dithiane (PubChem CID 14197979) has the molecular formula C13H24O2S4 and a molecular weight of 340.60 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethyl)-2-(1,3-dithian-2-ylmethyl)-1,3-dithiane.
| Compound Name | 2-(2,2-dimethoxyethyl)-2-(1,3-dithian-2-ylmethyl)-1,3-dithiane |
|---|---|
| PubChem CID | 14197979 |
| Molecular Formula | C13H24O2S4 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 2-(2,2-dimethoxyethyl)-2-(1,3-dithian-2-ylmethyl)-1,3-dithiane |
| SMILES | COC(CC1(CC2SCCCS2)SCCCS1)OC |
| InChI | InChI=1S/C13H24O2S4/c1-14-11(15-2)9-13(18-7-4-8-19-13)10-12-16-5-3-6-17-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | CIBWTRLYNQIRQA-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|