C8H16S3 — CID 91806567
2-(2-methylsulfanylpropyl)-1,3-dithiane (PubChem CID 91806567) has the molecular formula C8H16S3 and a molecular weight of 208.42 g/mol. Its IUPAC name is 2-(2-methylsulfanylpropyl)-1,3-dithiane.
| Compound Name | 2-(2-methylsulfanylpropyl)-1,3-dithiane |
|---|---|
| PubChem CID | 91806567 |
| Molecular Formula | C8H16S3 |
| Molecular Weight | 208.42 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 2-(2-methylsulfanylpropyl)-1,3-dithiane |
| SMILES | CSC(C)CC1SCCCS1 |
| InChI | InChI=1S/C8H16S3/c1-7(9-2)6-8-10-4-3-5-11-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | DXEOZZRKRZVPBE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |