C11H20S2 — CID 134991075
2-[(E)-3-methylhex-2-enyl]-1,3-dithiane (PubChem CID 134991075) has the molecular formula C11H20S2 and a molecular weight of 216.41 g/mol. Its IUPAC name is 2-[(E)-3-methylhex-2-enyl]-1,3-dithiane.
| Compound Name | 2-[(E)-3-methylhex-2-enyl]-1,3-dithiane |
|---|---|
| PubChem CID | 134991075 |
| Molecular Formula | C11H20S2 |
| Molecular Weight | 216.41 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-[(E)-3-methylhex-2-enyl]-1,3-dithiane |
| SMILES | CCC/C(C)=C/CC1SCCCS1 |
| InChI | InChI=1S/C11H20S2/c1-3-5-10(2)6-7-11-12-8-4-9-13-11/h6,11H,3-5,7-9H2,1-2H3/b10-6+ |
| InChIKey | YHCIYRDTXDPDKQ-UXBLZVDNSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|