C11H20S2 — CID 5372644
2-[(E)-hept-3-en-3-yl]-1,3-dithiane (PubChem CID 5372644) has the molecular formula C11H20S2 and a molecular weight of 216.41 g/mol. Its IUPAC name is 2-[(E)-hept-3-en-3-yl]-1,3-dithiane.
| Compound Name | 2-[(E)-hept-3-en-3-yl]-1,3-dithiane |
|---|---|
| PubChem CID | 5372644 |
| Molecular Formula | C11H20S2 |
| Molecular Weight | 216.41 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-[(E)-hept-3-en-3-yl]-1,3-dithiane |
| SMILES | CCC/C=C(\CC)C1SCCCS1 |
| InChI | InChI=1S/C11H20S2/c1-3-5-7-10(4-2)11-12-8-6-9-13-11/h7,11H,3-6,8-9H2,1-2H3/b10-7+ |
| InChIKey | WJOUSDVCMJILRF-JXMROGBWSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|