C10H18N2O2S2 — CID 174426200
N-(1-amino-1-oxopentan-2-yl)-1,3-dithiane-2-carboxamide (PubChem CID 174426200) has the molecular formula C10H18N2O2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is N-(1-amino-1-oxopentan-2-yl)-1,3-dithiane-2-carboxamide.
| Compound Name | N-(1-amino-1-oxopentan-2-yl)-1,3-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 174426200 |
| Molecular Formula | C10H18N2O2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | N-(1-amino-1-oxopentan-2-yl)-1,3-dithiane-2-carboxamide |
| SMILES | CCCC(NC(=O)C1SCCCS1)C(N)=O |
| InChI | InChI=1S/C10H18N2O2S2/c1-2-4-7(8(11)13)12-9(14)10-15-5-3-6-16-10/h7,10H,2-6H2,1H3,(H2,11,13)(H,12,14) |
| InChIKey | XRGDRUPCGORNJI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |