C14H25N3O4 — CID 143100942
(2S)-N-(1-amino-1,2-dioxohexan-3-yl)-1-(ethoxymethyl)pyrrolidine-2-carboxamide (PubChem CID 143100942) has the molecular formula C14H25N3O4 and a molecular weight of 299.37 g/mol. Its IUPAC name is (2S)-N-(1-amino-1,2-dioxohexan-3-yl)-1-(ethoxymethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(1-amino-1,2-dioxohexan-3-yl)-1-(ethoxymethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143100942 |
| Molecular Formula | C14H25N3O4 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | (2S)-N-(1-amino-1,2-dioxohexan-3-yl)-1-(ethoxymethyl)pyrrolidine-2-carboxamide |
| SMILES | CCCC(NC(=O)[C@@H]1CCCN1COCC)C(=O)C(N)=O |
| InChI | InChI=1S/C14H25N3O4/c1-3-6-10(12(18)13(15)19)16-14(20)11-7-5-8-17(11)9-21-4-2/h10-11H,3-9H2,1-2H3,(H2,15,19)(H,16,20)/t10?,11-/m0/s1 |
| InChIKey | DJYLQJPQQZMQMD-DTIOYNMSSA-N |
| XLogP | -0.22 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|