C24H41N5O5 — CID 76749559
N-(1-amino-1,2-dioxohexan-3-yl)-1-[2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]pyrrolidine-2-carboxamide (PubChem CID 76749559) has the molecular formula C24H41N5O5 and a molecular weight of 479.62 g/mol. Its IUPAC name is N-(1-amino-1,2-dioxohexan-3-yl)-1-[2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(1-amino-1,2-dioxohexan-3-yl)-1-[2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 76749559 |
| Molecular Formula | C24H41N5O5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.31 |
| IUPAC Name | N-(1-amino-1,2-dioxohexan-3-yl)-1-[2-(tert-butylcarbamoylamino)-2-cyclohexylacetyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC(NC(=O)C1CCCN1C(=O)C(NC(=O)NC(C)(C)C)C1CCCCC1)C(=O)C(N)=O |
| InChI | InChI=1S/C24H41N5O5/c1-5-10-16(19(30)20(25)31)26-21(32)17-13-9-14-29(17)22(33)18(15-11-7-6-8-12-15)27-23(34)28-24(2,3)4/h15-18H,5-14H2,1-4H3,(H2,25,31)(H,26,32)(H2,27,28,34) |
| InChIKey | LQDXEWVXROALEE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|