C33H49N5O7 — CID 58262629
tert-butyl N-[2-[(2S)-2-[[1-(2-benzamidoethylamino)-1,2-dioxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-1-cyclohexyl-2-oxoethyl]carbamate (PubChem CID 58262629) has the molecular formula C33H49N5O7 and a molecular weight of 627.78 g/mol. Its IUPAC name is tert-butyl N-[2-[(2S)-2-[[1-(2-benzamidoethylamino)-1,2-dioxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-1-cyclohexyl-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2S)-2-[[1-(2-benzamidoethylamino)-1,2-dioxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58262629 |
| Molecular Formula | C33H49N5O7 |
| Molecular Weight | 627.78 g/mol |
| Exact Mass | 627.36 |
| IUPAC Name | tert-butyl N-[2-[(2S)-2-[[1-(2-benzamidoethylamino)-1,2-dioxohexan-3-yl]carbamoyl]pyrrolidin-1-yl]-1-cyclohexyl-2-oxoethyl]carbamate |
| SMILES | CCCC(NC(=O)[C@@H]1CCCN1C(=O)C(NC(=O)OC(C)(C)C)C1CCCCC1)C(=O)C(=O)NCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H49N5O7/c1-5-13-24(27(39)30(42)35-20-19-34-28(40)23-16-10-7-11-17-23)36-29(41)25-18-12-21-38(25)31(43)26(22-14-8-6-9-15-22)37-32(44)45-33(2,3)4/h7,10-11,16-17,22,24-26H,5-6,8-9,12-15,18-21H2,1-4H3,(H,34,40)(H,35,42)(H,36,41)(H,37,44)/t24?,25-,26?/m0/s1 |
| InChIKey | LBOQYDBWXLTAHD-JNLGVIEDSA-N |
| XLogP | 2.85 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|