C29H46Cl2N4O6 — CID 159750283
tert-butyl N-[(1S)-1-cyclohexyl-2-[(2S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate;dichloromethane (PubChem CID 159750283) has the molecular formula C29H46Cl2N4O6 and a molecular weight of 617.62 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-cyclohexyl-2-[(2S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate;dichloromethane.
| Compound Name | tert-butyl N-[(1S)-1-cyclohexyl-2-[(2S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate;dichloromethane |
|---|---|
| PubChem CID | 159750283 |
| Molecular Formula | C29H46Cl2N4O6 |
| Molecular Weight | 617.62 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | tert-butyl N-[(1S)-1-cyclohexyl-2-[(2S)-2-[[1,2-dioxo-1-(prop-2-enylamino)hept-6-en-3-yl]carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]carbamate;dichloromethane |
| SMILES | C=CCCC(NC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)OC(C)(C)C)C1CCCCC1)C(=O)C(=O)NCC=C.ClCCl |
| InChI | InChI=1S/C28H44N4O6.CH2Cl2/c1-6-8-15-20(23(33)25(35)29-17-7-2)30-24(34)21-16-12-18-32(21)26(36)22(19-13-10-9-11-14-19)31-27(37)38-28(3,4)5;2-1-3/h6-7,19-22H,1-2,8-18H2,3-5H3,(H,29,35)(H,30,34)(H,31,37);1H2/t20?,21-,22-;/m0./s1 |
| InChIKey | NDOIDFCUWAYBBV-HGDDKUDHSA-N |
| XLogP | 4.19 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|