C34H57ClN4O6 — CID 142268365
acetylene;tert-butyl N-[1-cyclohexyl-2-[(4R)-2-[[1,2-dioxo-1-(propylamino)hept-6-en-3-yl]carbamoyl]-4-propylpyrrolidin-1-yl]-2-oxoethyl]carbamate;chloromethane (PubChem CID 142268365) has the molecular formula C34H57ClN4O6 and a molecular weight of 653.31 g/mol. Its IUPAC name is acetylene;tert-butyl N-[1-cyclohexyl-2-[(4R)-2-[[1,2-dioxo-1-(propylamino)hept-6-en-3-yl]carbamoyl]-4-propylpyrrolidin-1-yl]-2-oxoethyl]carbamate;chloromethane.
| Compound Name | acetylene;tert-butyl N-[1-cyclohexyl-2-[(4R)-2-[[1,2-dioxo-1-(propylamino)hept-6-en-3-yl]carbamoyl]-4-propylpyrrolidin-1-yl]-2-oxoethyl]carbamate;chloromethane |
|---|---|
| PubChem CID | 142268365 |
| Molecular Formula | C34H57ClN4O6 |
| Molecular Weight | 653.31 g/mol |
| Exact Mass | 652.40 |
| IUPAC Name | acetylene;tert-butyl N-[1-cyclohexyl-2-[(4R)-2-[[1,2-dioxo-1-(propylamino)hept-6-en-3-yl]carbamoyl]-4-propylpyrrolidin-1-yl]-2-oxoethyl]carbamate;chloromethane |
| SMILES | C#C.C=CCCC(NC(=O)C1C[C@@H](CCC)CN1C(=O)C(NC(=O)OC(C)(C)C)C1CCCCC1)C(=O)C(=O)NCCC.CCl |
| InChI | InChI=1S/C31H52N4O6.C2H2.CH3Cl/c1-7-10-17-23(26(36)28(38)32-18-9-3)33-27(37)24-19-21(14-8-2)20-35(24)29(39)25(22-15-12-11-13-16-22)34-30(40)41-31(4,5)6;2*1-2/h7,21-25H,1,8-20H2,2-6H3,(H,32,38)(H,33,37)(H,34,40);1-2H;1H3/t21-,23?,24?,25?;;/m1../s1 |
| InChIKey | OMBUIJMNUSSGKR-ZNLRUDIBSA-N |
| XLogP | 5.13 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.31 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|